# descriptastorus **Repository Path**: jourmore/descriptastorus ## Basic Information - **Project Name**: descriptastorus - **Description**: No description available - **Primary Language**: Unknown - **License**: Not specified - **Default Branch**: master - **Homepage**: None - **GVP Project**: No ## Statistics - **Stars**: 0 - **Forks**: 1 - **Created**: 2022-03-25 - **Last Updated**: 2024-10-29 ## Categories & Tags **Categories**: Uncategorized **Tags**: None ## README DescriptaStorus =============== The descriptastorus provides 1. fast random access to rows of properties suitable for machine learning and 2. fast random access to indexed molecule files 3. A mechanism for generating new descriptors for new molecules 4. A mechanism for validating that you can recreate the same storage in different software/hardware environments 5. An easy script for making your own descriptor files from raw data. [n.b.] kyotocabinet is required to read/write the inchiKey and name indices This should be installed in your environment. There are three basic ways to use DescriptaStorus: 1. Make a DescriptaStore using a script 2. Append new data to the store 3. Use a DescriptaStore to access properties Installing ========== ``` 1. install rdkit 2. install scikit-learn pip install git+https://github.com/bp-kelley/descriptastorus ``` Requirements are in the setup.py file, but essentially: 1. python2/3 2. rdkit 3. [optional but highly recommended] kyotocabinet Using RDKit descriptors ======================= Grab a descriptor generator from the registry. Currently registered descriptors: * atompaircounts * morgan3counts * morganchiral3counts * morganfeature3counts * rdkit2d * rdkit2dnormalized * rdkitfpbits Descriptors are input as a tuple or list to the generator. ``` from descriptastorus.descriptors.DescriptorGenerator import MakeGenerator generator = MakeGenerator(("RDKit2D",)) for name, numpy_type in generator.GetColumns(): print("name: {} data type: {}".format(name, numpy_type)) ``` The resulting columns and datatypes look like: ``` name: RDKit2D_calculated data type: name: BalabanJ data type: name: BertzCT data type: name: Chi0 data type: name: Chi0n data type: name: Chi0v data type: name: Chi1 data type: ``` Note: RDKit2D_calculated is just a flag for the store to indicate that the RDKit2D features were successfully calculated. To get combine multiple generators simply add them to the list of desired datatypes: ``` from descriptastorus.descriptors.DescriptorGenerator import MakeGenerator generator = MakeGenerator(("RDKit2D", "Morgan3Counts")) smiles = "c1ccccc1" data = generator.process(smiles) assert data[0] is True ``` The first element is True if the molecule was successfully processed, this is used in the descriptastor to indicate that the row is valid. If a molecule is unsuccessfully processed, None is returned ``` data = generator.process("not a smiles") assert data is None ``` Individual descriptor sets can also be used outside of the generator. ``` from descriptastorus.descriptors import rdNormalizedDescriptors from rdkit import Chem import logging # make the normalized descriptor generator generator = rdNormalizedDescriptors.RDKit2DNormalized() generator.columns # list of tuples: (descriptor_name, numpytype) ... # features = generator.process(smiles) # features[0] is True/False if the smiles could be processed correcty # features[1:] are the normalized descriptors as described in generator.columns # example for converting a smiles string into the values def rdkit_2d_normalized_features(smiles: str):     # n.b. the first element is true/false if the descriptors were properly computed results = generator.process(smiles)[ processed, features = results[0], results[1:] if processed is None: logging.warning("Unable to process smiles %s", smiles) # if processed is None, the features are are default values for the type     return features ``` Making a DescriptaStore ======================= see scripts/storus.py for more details: ``` usage: storus.py [-h] [--hasHeader] [--index-inchikey] [--smilesColumn SMILESCOLUMN] [--nameColumn NAMECOLUMN] [--seperator SEPERATOR] smilesfile storage positional arguments: smilesfile file containing smiles strings storage directory in which to store the descriptors optional arguments: -h, --help show this help message and exit --hasHeader Indicate whether the smiles file has a header row --index-inchikey Optionally index the descriptors with inchi keys --smilesColumn SMILESCOLUMN Row index (or header name if the file has a header) for the smiles column --nameColumn NAMECOLUMN Row index (or header name if the file has a header) for the name column --seperator SEPERATOR Row index (or header name if the file has a header) for the name column ``` Example: Suppose you have a smiles file like the following: ``` SMILES STRU_ID c1ccccc1 NAME ``` This is a whitespace seperated file with a header. To make the standard storage and also index the inchikey: ``` python scripts/storus.py --smilesColumn=SMILES --nameColumn=STRU_ID --hasHeader --index-inchikey \ --seperator=" " \ smiles.txt mysmiles-store ``` Note that smiles files are very seperator dependent. If the smiles or name column can't be found, it is might be because the seperator is misspecified. The default properties created are 'Morgan3Counts,RDKit2D'. Using a DescriptaStore ====================== Using the descriptastore (the descriptastore is a directory of files): ``` from descriptastorus import DescriptaStore d = DescriptaStore("/db/cix/descriptastorus/store") # print out the column names print(d.descriptors().colnames) # this will take a while! for moldata, descriptors in d: smiles, name = moldata descriptors # is a numpy array of data morgan3 counts + rdkit descriptors ``` Note that the descriptors may contain status flags named as "X_Calculated" where X is one of the descriptor sets, such as RDKit2D. These are not returned by the iterator, or through the following api points: ``` colnames = d.getDescriptorNames() descriptors = d.getDescriptors(index) for moldata, descriptors in d: ... ``` To obtain these flags, you can either set the keepCalculatedFlags option ``` colnames = d.getDescriptorNames(keepCalculatedFlags=True) descriptors = d.getDescriptors(keepCalculatedFlags=True) ``` or use the direct descriptor interface: ``` # to iterate through only the descriptors: for descriptors in d.descriptors(): ... ``` # to lookup by name (requires kyotocabinet) ``` rows = [] for name in names: rows.extend( d.lookupName(name) ) # sorting the rows helps with disk seeking rows.sort() for row in rows: descriptors = d.getDescriptors(row) ... ``` # To lookup by inchikey (requires kyotocabinet) ``` rows = [] for key in inchiKeys: rows.extend( d.lookupInchiKey(key) ) rows.sort() for row in rows: descriptors = d.descriptors().get(row) smiles, name = d.molIndex().get(row) ... ``` Doing things yourself ===================== Creating a Raw store -------------------- The storage system is quite simple. It is made by specifying the column names and numpy types to store and also the number of rows to initialize. Example: ``` >>> from descriptastorus import raw >>> import numpy >>> columns = [('exactmw', numpy.float64), ('numRotatableBonds', numpy.int32) ...] >>> r = raw.MakeStore( columns, 2, "store") >>> r.putRow(0, [45.223, 3]) ``` Using an existing store ----------------------- After creation, to open the read only storage: ``` >>> r = raw.RawStore("store") ``` Get the number or rows: ``` >>> r.N 2 ``` Get the column names: ``` >>> r.colnames ['exactmw', 'numRotatableBonds'] ``` Extract the column: ``` >>> r.get(0) [45.223, 3] ``` Make a MolFileIndex =================== If the smiles file has a header ``` >>> from descriptastorus import MolFileIndex >>> index = MolFileIndex.MakeSmilesIndex("data/test1.smi", "test1", hasHeader=True, ... smilesColumn="smiles", nameColumn="name") >>> index.N 13 >>> index.getMol(12) 'c1ccccc1CCCCCCCCCCCC' >>> index.getName(12) 13 ``` If the smiles file has no header ``` >>> from descriptastorus import MolFileIndex >>> index = MolFileIndex.MakeSmilesIndex("data/test2.smi", "test2", hasHeader=False, ... smilesColumn=1, nameColumn=0) >>> index.N 13 >>> index.getMol(12) 'c1ccccc1CCCCCCCCCCCC' >>> index.getName(12) 13 ``` Use a MolFileIndex ================== Using a molfile index is fairly simple: ``` >>> from descriptastorus import MolFileIndex >>> idx = MolFileIndex("/db/cix/descriptastorus/test") >>> idx.get(1000) ['CC(C)(O)c1ccc(nc1)c4ccc3C=CN(Cc2ccc(F)cc2)c3c4', 'XX-AAAA'] >>> idx.getName(1000) 'XX-AAAA' >>> idx.getMol(1000) CC(C)(O)c1ccc(nc1)c4ccc3C=CN(Cc2ccc(F)cc2)c3c4' ``` Installation ============ ``` git clone https://bitbucket.org/novartisnibr/rdkit-descriptastorus.git cd rdkit-descriptastorus python setup.py install ``` TODO: * fast forwards iteration (fast now, but could be faster) * faster append-only store creation * Fast molecule indexing/lookup (almost done) * Output to bcolz pandas backend